About 1-ethyl-1-methylsilinane;hydron
1-ethyl-1-methylsilinane;hydron (PubChem CID 174791103) has the molecular formula C8H19Si+
and a molecular weight of 143.33 g/mol. Its IUPAC name is 1-ethyl-1-methylsilinane;hydron.
Molecular Properties
| Compound Name | 1-ethyl-1-methylsilinane;hydron |
| PubChem CID | 174791103 |
| Molecular Formula | C8H19Si+ |
| Molecular Weight | 143.33 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 1-ethyl-1-methylsilinane;hydron |
| SMILES | CC[Si]1(C)CCCCC1.[H+] |
| InChI | InChI=1S/C8H18Si/c1-3-9(2)7-5-4-6-8-9/h3-8H2,1-2H3/p+1 |
| InChIKey | GFSKKMHMEYKNIK-UHFFFAOYSA-O |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-methylsilinane;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-methylsilinane;hydron?
The IUPAC name of 1-ethyl-1-methylsilinane;hydron (CID 174791103) is 1-ethyl-1-methylsilinane;hydron.
What is the SMILES notation for 1-ethyl-1-methylsilinane;hydron?
The canonical SMILES for 1-ethyl-1-methylsilinane;hydron is CC[Si]1(C)CCCCC1.[H+].
What is the InChIKey of 1-ethyl-1-methylsilinane;hydron?
The InChIKey is GFSKKMHMEYKNIK-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H18Si/c1-3-9(2)7-5-4-6-8-9/h3-8H2,1-2H3/p+1.
What are the key properties of 1-ethyl-1-methylsilinane;hydron?
1-ethyl-1-methylsilinane;hydron has a molecular weight of 143.33 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-methylsilinane;hydron is sourced from PubChem (CID 174791103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).