C15H28Si — CID 67255329
1,1-bis(pent-2-enyl)silinane (PubChem CID 67255329) has the molecular formula C15H28Si and a molecular weight of 236.47 g/mol. Its IUPAC name is 1,1-bis(pent-2-enyl)silinane.
| Compound Name | 1,1-bis(pent-2-enyl)silinane |
|---|---|
| PubChem CID | 67255329 |
| Molecular Formula | C15H28Si |
| Molecular Weight | 236.47 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 1,1-bis(pent-2-enyl)silinane |
| SMILES | CCC=CC[Si]1(CC=CCC)CCCCC1 |
| InChI | InChI=1S/C15H28Si/c1-3-5-8-12-16(13-9-6-4-2)14-10-7-11-15-16/h5-6,8-9H,3-4,7,10-15H2,1-2H3 |
| InChIKey | CVMXDLQVNYMONZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|