C13H24N+ — CID 123773033
1,1-bis(but-1-enyl)piperidin-1-ium (PubChem CID 123773033) has the molecular formula C13H24N+ and a molecular weight of 194.34 g/mol. Its IUPAC name is 1,1-bis(but-1-enyl)piperidin-1-ium.
| Compound Name | 1,1-bis(but-1-enyl)piperidin-1-ium |
|---|---|
| PubChem CID | 123773033 |
| Molecular Formula | C13H24N+ |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.19 |
| IUPAC Name | 1,1-bis(but-1-enyl)piperidin-1-ium |
| SMILES | CCC=C[N+]1(C=CCC)CCCCC1 |
| InChI | InChI=1S/C13H24N/c1-3-5-10-14(11-6-4-2)12-8-7-9-13-14/h5-6,10-11H,3-4,7-9,12-13H2,1-2H3/q+1 |
| InChIKey | BQSBGILAKGQOOH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|