C13H26N+ — CID 20676422
2,3-diethyl-5-azoniaspiro[4.5]decane (PubChem CID 20676422) has the molecular formula C13H26N+ and a molecular weight of 196.36 g/mol. Its IUPAC name is 2,3-diethyl-5-azoniaspiro[4.5]decane.
| Compound Name | 2,3-diethyl-5-azoniaspiro[4.5]decane |
|---|---|
| PubChem CID | 20676422 |
| Molecular Formula | C13H26N+ |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.21 |
| IUPAC Name | 2,3-diethyl-5-azoniaspiro[4.5]decane |
| SMILES | CCC1C[N+]2(CCCCC2)CC1CC |
| InChI | InChI=1S/C13H26N/c1-3-12-10-14(11-13(12)4-2)8-6-5-7-9-14/h12-13H,3-11H2,1-2H3/q+1 |
| InChIKey | ISDZPKQINPVUKN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|