C12H24BrN — CID 171336385
2,4-dimethyl-6-azoniaspiro[5.5]undecane bromide (PubChem CID 171336385) has the molecular formula C12H24BrN and a molecular weight of 262.23 g/mol. Its IUPAC name is 2,4-dimethyl-6-azoniaspiro[5.5]undecane bromide.
| Compound Name | 2,4-dimethyl-6-azoniaspiro[5.5]undecane bromide |
|---|---|
| PubChem CID | 171336385 |
| Molecular Formula | C12H24BrN |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2,4-dimethyl-6-azoniaspiro[5.5]undecane bromide |
| SMILES | CC1CC(C)C[N+]2(CCCCC2)C1.[Br-] |
| InChI | InChI=1S/C12H24N.BrH/c1-11-8-12(2)10-13(9-11)6-4-3-5-7-13;/h11-12H,3-10H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | XCSHWWKWXYQIGD-UHFFFAOYSA-M |
| XLogP | -0.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|