C12H24N+ — CID 121299550
8,9-dimethyl-5-azoniaspiro[4.6]undecane (PubChem CID 121299550) has the molecular formula C12H24N+ and a molecular weight of 182.33 g/mol. Its IUPAC name is 8,9-dimethyl-5-azoniaspiro[4.6]undecane.
| Compound Name | 8,9-dimethyl-5-azoniaspiro[4.6]undecane |
|---|---|
| PubChem CID | 121299550 |
| Molecular Formula | C12H24N+ |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.19 |
| IUPAC Name | 8,9-dimethyl-5-azoniaspiro[4.6]undecane |
| SMILES | CC1CC[N+]2(CCCC2)CCC1C |
| InChI | InChI=1S/C12H24N/c1-11-5-9-13(7-3-4-8-13)10-6-12(11)2/h11-12H,3-10H2,1-2H3/q+1 |
| InChIKey | ONVIQVXVXXEEEL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|