C13H29N — CID 161179695
carbanide;methane;2,3,8-trimethyl-5-azoniaspiro[4.4]nonane (PubChem CID 161179695) has the molecular formula C13H29N and a molecular weight of 199.38 g/mol. Its IUPAC name is carbanide;methane;2,3,8-trimethyl-5-azoniaspiro[4.4]nonane.
| Compound Name | carbanide;methane;2,3,8-trimethyl-5-azoniaspiro[4.4]nonane |
|---|---|
| PubChem CID | 161179695 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | carbanide;methane;2,3,8-trimethyl-5-azoniaspiro[4.4]nonane |
| SMILES | C.CC1CC[N+]2(C1)CC(C)C(C)C2.[CH3-] |
| InChI | InChI=1S/C11H22N.CH4.CH3/c1-9-4-5-12(6-9)7-10(2)11(3)8-12;;/h9-11H,4-8H2,1-3H3;1H4;1H3/q+1;;-1 |
| InChIKey | USGYFEBRYLASGL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|