About 5-azoniaspiro[4.4]nonane;chloride;hydrate
5-azoniaspiro[4.4]nonane;chloride;hydrate (PubChem CID 139201464) has the molecular formula C8H18ClNO
and a molecular weight of 179.69 g/mol. Its IUPAC name is 5-azoniaspiro[4.4]nonane;chloride;hydrate.
Molecular Properties
| Compound Name | 5-azoniaspiro[4.4]nonane;chloride;hydrate |
| PubChem CID | 139201464 |
| Molecular Formula | C8H18ClNO |
| Molecular Weight | 179.69 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 5-azoniaspiro[4.4]nonane;chloride;hydrate |
| SMILES | C1CC[N+]2(C1)CCCC2.O.[Cl-] |
| InChI | InChI=1S/C8H16N.ClH.H2O/c1-2-6-9(5-1)7-3-4-8-9;;/h1-8H2;1H;1H2/q+1;;/p-1 |
| InChIKey | PPFZGCWDSDVOBW-UHFFFAOYSA-M |
| XLogP | -2.43 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.69 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-azoniaspiro[4.4]nonane;chloride;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azoniaspiro[4.4]nonane;chloride;hydrate?
The IUPAC name of 5-azoniaspiro[4.4]nonane;chloride;hydrate (CID 139201464) is 5-azoniaspiro[4.4]nonane;chloride;hydrate.
What is the SMILES notation for 5-azoniaspiro[4.4]nonane;chloride;hydrate?
The canonical SMILES for 5-azoniaspiro[4.4]nonane;chloride;hydrate is C1CC[N+]2(C1)CCCC2.O.[Cl-].
What is the InChIKey of 5-azoniaspiro[4.4]nonane;chloride;hydrate?
The InChIKey is PPFZGCWDSDVOBW-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16N.ClH.H2O/c1-2-6-9(5-1)7-3-4-8-9;;/h1-8H2;1H;1H2/q+1;;/p-1.
What are the key properties of 5-azoniaspiro[4.4]nonane;chloride;hydrate?
5-azoniaspiro[4.4]nonane;chloride;hydrate has a molecular weight of 179.69 g/mol, XLogP of -2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azoniaspiro[4.4]nonane;chloride;hydrate is sourced from PubChem (CID 139201464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).