C26H54N3+3 — CID 58611498
3,4-bis[2-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)ethyl]-1,1-dimethylpyrrolidin-1-ium (PubChem CID 58611498) has the molecular formula C26H54N3+3 and a molecular weight of 408.74 g/mol. Its IUPAC name is 3,4-bis[2-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)ethyl]-1,1-dimethylpyrrolidin-1-ium.
| Compound Name | 3,4-bis[2-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)ethyl]-1,1-dimethylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 58611498 |
| Molecular Formula | C26H54N3+3 |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 408.43 |
| IUPAC Name | 3,4-bis[2-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)ethyl]-1,1-dimethylpyrrolidin-1-ium |
| SMILES | CCC1C[N+](C)(C)CC1CCC1C[N+](C)(C)CC1CCC1C[N+](C)(C)CC1CC |
| InChI | InChI=1S/C26H54N3/c1-9-21-15-27(3,4)17-23(21)11-13-25-19-29(7,8)20-26(25)14-12-24-18-28(5,6)16-22(24)10-2/h21-26H,9-20H2,1-8H3/q+3 |
| InChIKey | RUOSSHNMVAIOCO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|