C13H26NO+ — CID 20676421
2,3-diethyl-5-azoniaspiro[4.5]decan-8-ol (PubChem CID 20676421) has the molecular formula C13H26NO+ and a molecular weight of 212.36 g/mol. Its IUPAC name is 2,3-diethyl-5-azoniaspiro[4.5]decan-8-ol.
| Compound Name | 2,3-diethyl-5-azoniaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 20676421 |
| Molecular Formula | C13H26NO+ |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | 2,3-diethyl-5-azoniaspiro[4.5]decan-8-ol |
| SMILES | CCC1C[N+]2(CCC(O)CC2)CC1CC |
| InChI | InChI=1S/C13H26NO/c1-3-11-9-14(10-12(11)4-2)7-5-13(15)6-8-14/h11-13,15H,3-10H2,1-2H3/q+1 |
| InChIKey | XPSZXURCZFKNFE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|