C6H14INO — CID 146627833
(3R)-1,1-dimethylpyrrolidin-1-ium-3-ol iodide (PubChem CID 146627833) has the molecular formula C6H14INO and a molecular weight of 243.09 g/mol. Its IUPAC name is (3R)-1,1-dimethylpyrrolidin-1-ium-3-ol iodide.
| Compound Name | (3R)-1,1-dimethylpyrrolidin-1-ium-3-ol iodide |
|---|---|
| PubChem CID | 146627833 |
| Molecular Formula | C6H14INO |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | (3R)-1,1-dimethylpyrrolidin-1-ium-3-ol iodide |
| SMILES | C[N+]1(C)CC[C@@H](O)C1.[I-] |
| InChI | InChI=1S/C6H14NO.HI/c1-7(2)4-3-6(8)5-7;/h6,8H,3-5H2,1-2H3;1H/q+1;/p-1/t6-;/m1./s1 |
| InChIKey | ZTRKDLPOEOIXKS-FYZOBXCZSA-M |
| XLogP | -3.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|