C8H18NO+ — CID 7168625
(3R,4S)-1,1,3-trimethylpiperidin-1-ium-4-ol (PubChem CID 7168625) has the molecular formula C8H18NO+ and a molecular weight of 144.24 g/mol. Its IUPAC name is (3R,4S)-1,1,3-trimethylpiperidin-1-ium-4-ol.
| Compound Name | (3R,4S)-1,1,3-trimethylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7168625 |
| Molecular Formula | C8H18NO+ |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | (3R,4S)-1,1,3-trimethylpiperidin-1-ium-4-ol |
| SMILES | C[C@@H]1C[N+](C)(C)CC[C@@H]1O |
| InChI | InChI=1S/C8H18NO/c1-7-6-9(2,3)5-4-8(7)10/h7-8,10H,4-6H2,1-3H3/q+1/t7-,8+/m1/s1 |
| InChIKey | XARDSTDONFXIFV-SFYZADRCSA-N |
| XLogP | 0.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|