About cis-(1S,2R)-4,4-dideuterio-2-methylcyclopentan-1-ol
cis-(1S,2R)-4,4-dideuterio-2-methylcyclopentan-1-ol (PubChem CID 171581975) has the molecular formula C6H12O
and a molecular weight of 102.17 g/mol. Its IUPAC name is cis-(1S,2R)-4,4-dideuterio-2-methylcyclopentan-1-ol.
Analyze cis-(1S,2R)-4,4-dideuterio-2-methylcyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-4,4-dideuterio-2-methylcyclopentan-1-ol?
The IUPAC name of cis-(1S,2R)-4,4-dideuterio-2-methylcyclopentan-1-ol (CID 171581975) is cis-(1S,2R)-4,4-dideuterio-2-methylcyclopentan-1-ol.
What is the SMILES notation for cis-(1S,2R)-4,4-dideuterio-2-methylcyclopentan-1-ol?
The canonical SMILES for cis-(1S,2R)-4,4-dideuterio-2-methylcyclopentan-1-ol is [2H]C1([2H])C[C@@H](C)[C@@H](O)C1.
What is the InChIKey of cis-(1S,2R)-4,4-dideuterio-2-methylcyclopentan-1-ol?
The InChIKey is BVIJQMCYYASIFP-QHLOMELNSA-N. The full InChI is InChI=1S/C6H12O/c1-5-3-2-4-6(5)7/h5-7H,2-4H2,1H3/t5-,6+/m1/s1/i2D2.
What are the key properties of cis-(1S,2R)-4,4-dideuterio-2-methylcyclopentan-1-ol?
cis-(1S,2R)-4,4-dideuterio-2-methylcyclopentan-1-ol has a molecular weight of 102.17 g/mol, XLogP of 1.17, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-4,4-dideuterio-2-methylcyclopentan-1-ol is sourced from PubChem (CID 171581975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).