C6H13NO2 — CID 89166357
(3S)-1,4-dimethyl-1-oxidopyrrolidin-1-ium-3-ol (PubChem CID 89166357) has the molecular formula C6H13NO2 and a molecular weight of 131.18 g/mol. Its IUPAC name is (3S)-1,4-dimethyl-1-oxidopyrrolidin-1-ium-3-ol.
| Compound Name | (3S)-1,4-dimethyl-1-oxidopyrrolidin-1-ium-3-ol |
|---|---|
| PubChem CID | 89166357 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (3S)-1,4-dimethyl-1-oxidopyrrolidin-1-ium-3-ol |
| SMILES | CC1C[N+](C)([O-])C[C@H]1O |
| InChI | InChI=1S/C6H13NO2/c1-5-3-7(2,9)4-6(5)8/h5-6,8H,3-4H2,1-2H3/t5?,6-,7?/m1/s1 |
| InChIKey | PWJFNEYEJJOCGI-YURFNIAASA-N |
| XLogP | -0.06 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|