C11H21NO2 — CID 163185831
(2S,4S,4aR,7S,7aS)-2,4,7-trimethyl-2-oxido-3,4,4a,5,6,7-hexahydro-1H-cyclopenta[c]pyridin-2-ium-7a-ol (PubChem CID 163185831) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (2S,4S,4aR,7S,7aS)-2,4,7-trimethyl-2-oxido-3,4,4a,5,6,7-hexahydro-1H-cyclopenta[c]pyridin-2-ium-7a-ol.
| Compound Name | (2S,4S,4aR,7S,7aS)-2,4,7-trimethyl-2-oxido-3,4,4a,5,6,7-hexahydro-1H-cyclopenta[c]pyridin-2-ium-7a-ol |
|---|---|
| PubChem CID | 163185831 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (2S,4S,4aR,7S,7aS)-2,4,7-trimethyl-2-oxido-3,4,4a,5,6,7-hexahydro-1H-cyclopenta[c]pyridin-2-ium-7a-ol |
| SMILES | C[C@@H]1C[N@+](C)([O-])C[C@@]2(O)[C@@H]1CC[C@@H]2C |
| InChI | InChI=1S/C11H21NO2/c1-8-6-12(3,14)7-11(13)9(2)4-5-10(8)11/h8-10,13H,4-7H2,1-3H3/t8-,9+,10-,11+,12+/m1/s1 |
| InChIKey | WNNYIIINIZJRMW-LVEVGFFFSA-N |
| XLogP | 1.36 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|