1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid

C8H14O3 — CID 83905293

IUPAC1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid
SMILESCC1CCC(C)C1(O)C(=O)O
InChIInChI=1S/C8H14O3/c1-5-3-4-6(2)8(5,11)7(9)10/h5-6,11H,3-4H2,1-2H3,(H,9,10)
InChIKeyXOULMTJYXLWGBP-UHFFFAOYSA-N
MW158.20 g/mol
LogP0.87
Rot. Bonds1

About 1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid

1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid (PubChem CID 83905293) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid
PubChem CID83905293
Molecular FormulaC8H14O3
Molecular Weight158.20 g/mol
Exact Mass158.09
IUPAC Name1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid
SMILESCC1CCC(C)C1(O)C(=O)O
InChIInChI=1S/C8H14O3/c1-5-3-4-6(2)8(5,11)7(9)10/h5-6,11H,3-4H2,1-2H3,(H,9,10)
InChIKeyXOULMTJYXLWGBP-UHFFFAOYSA-N
XLogP0.87
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.20
LogP ≤ 50.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid?
The IUPAC name of 1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid (CID 83905293) is 1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid?
The canonical SMILES for 1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid is CC1CCC(C)C1(O)C(=O)O.
What is the InChIKey of 1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid?
The InChIKey is XOULMTJYXLWGBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-5-3-4-6(2)8(5,11)7(9)10/h5-6,11H,3-4H2,1-2H3,(H,9,10).
What are the key properties of 1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid?
1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid has a molecular weight of 158.20 g/mol, XLogP of 0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,5-dimethylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 83905293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).