C7H14NO3+ — CID 16758141
(3R)-4-hydroxy-1,1-dimethylpyrrolidin-1-ium-3-carboxylic acid (PubChem CID 16758141) has the molecular formula C7H14NO3+ and a molecular weight of 160.19 g/mol. Its IUPAC name is (3R)-4-hydroxy-1,1-dimethylpyrrolidin-1-ium-3-carboxylic acid.
| Compound Name | (3R)-4-hydroxy-1,1-dimethylpyrrolidin-1-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 16758141 |
| Molecular Formula | C7H14NO3+ |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | (3R)-4-hydroxy-1,1-dimethylpyrrolidin-1-ium-3-carboxylic acid |
| SMILES | C[N+]1(C)CC(O)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C7H13NO3/c1-8(2)3-5(7(10)11)6(9)4-8/h5-6,9H,3-4H2,1-2H3/p+1/t5-,6?/m1/s1 |
| InChIKey | WTBNMEWVZFFAPJ-LWOQYNTDSA-O |
| XLogP | -0.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|