C7H15NO4 — CID 90895389
(3R)-1,2-dimethyl-1-oxidopiperidin-1-ium-3,4,5-triol (PubChem CID 90895389) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is (3R)-1,2-dimethyl-1-oxidopiperidin-1-ium-3,4,5-triol.
| Compound Name | (3R)-1,2-dimethyl-1-oxidopiperidin-1-ium-3,4,5-triol |
|---|---|
| PubChem CID | 90895389 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (3R)-1,2-dimethyl-1-oxidopiperidin-1-ium-3,4,5-triol |
| SMILES | CC1[C@@H](O)C(O)C(O)C[N+]1(C)[O-] |
| InChI | InChI=1S/C7H15NO4/c1-4-6(10)7(11)5(9)3-8(4,2)12/h4-7,9-11H,3H2,1-2H3/t4?,5?,6-,7?,8?/m1/s1 |
| InChIKey | AKPSUKLXTBUMRW-OMLXPJATSA-N |
| XLogP | -1.58 |
| TPSA | 83.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|