C7H14O4 — CID 14158486
(1S,2S,3R,4S,5R)-5-methylcyclohexane-1,2,3,4-tetrol (PubChem CID 14158486) has the molecular formula C7H14O4 and a molecular weight of 162.19 g/mol. Its IUPAC name is (1S,2S,3R,4S,5R)-5-methylcyclohexane-1,2,3,4-tetrol.
| Compound Name | (1S,2S,3R,4S,5R)-5-methylcyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 14158486 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (1S,2S,3R,4S,5R)-5-methylcyclohexane-1,2,3,4-tetrol |
| SMILES | C[C@@H]1C[C@H](O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H14O4/c1-3-2-4(8)6(10)7(11)5(3)9/h3-11H,2H2,1H3/t3-,4+,5+,6+,7-/m1/s1 |
| InChIKey | UTJYMNZLKFABJE-PFCGLBSHSA-N |
| XLogP | -1.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |