C12H24INO — CID 10734822
(4S,4aR,6R,7R,7aR)-2,2,4,7-tetramethyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-ium-6-ol iodide (PubChem CID 10734822) has the molecular formula C12H24INO and a molecular weight of 325.23 g/mol. Its IUPAC name is (4S,4aR,6R,7R,7aR)-2,2,4,7-tetramethyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-ium-6-ol iodide.
| Compound Name | (4S,4aR,6R,7R,7aR)-2,2,4,7-tetramethyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-ium-6-ol iodide |
|---|---|
| PubChem CID | 10734822 |
| Molecular Formula | C12H24INO |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (4S,4aR,6R,7R,7aR)-2,2,4,7-tetramethyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-ium-6-ol iodide |
| SMILES | C[C@@H]1[C@@H]2C[N+](C)(C)C[C@@H](C)[C@H]2C[C@H]1O.[I-] |
| InChI | InChI=1S/C12H24NO.HI/c1-8-6-13(3,4)7-11-9(2)12(14)5-10(8)11;/h8-12,14H,5-7H2,1-4H3;1H/q+1;/p-1/t8-,9-,10-,11+,12-;/m1./s1 |
| InChIKey | INRUJTMBKBZWGI-STGDQAPHSA-M |
| XLogP | -1.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|