C6H13BrN+ — CID 146629635
3-bromo-1,1-dimethylpyrrolidin-1-ium (PubChem CID 146629635) has the molecular formula C6H13BrN+ and a molecular weight of 179.08 g/mol. Its IUPAC name is 3-bromo-1,1-dimethylpyrrolidin-1-ium.
| Compound Name | 3-bromo-1,1-dimethylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 146629635 |
| Molecular Formula | C6H13BrN+ |
| Molecular Weight | 179.08 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 3-bromo-1,1-dimethylpyrrolidin-1-ium |
| SMILES | C[N+]1(C)CCC(Br)C1 |
| InChI | InChI=1S/C6H13BrN/c1-8(2)4-3-6(7)5-8/h6H,3-5H2,1-2H3/q+1 |
| InChIKey | FPAHFJZWMFWREZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.08 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|