C11H24IN — CID 71352793
4-tert-butyl-1,1-dimethylpiperidin-1-ium iodide (PubChem CID 71352793) has the molecular formula C11H24IN and a molecular weight of 297.22 g/mol. Its IUPAC name is 4-tert-butyl-1,1-dimethylpiperidin-1-ium iodide.
| Compound Name | 4-tert-butyl-1,1-dimethylpiperidin-1-ium iodide |
|---|---|
| PubChem CID | 71352793 |
| Molecular Formula | C11H24IN |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-tert-butyl-1,1-dimethylpiperidin-1-ium iodide |
| SMILES | CC(C)(C)C1CC[N+](C)(C)CC1.[I-] |
| InChI | InChI=1S/C11H24N.HI/c1-11(2,3)10-6-8-12(4,5)9-7-10;/h10H,6-9H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | GYJFSEUIHZNBJC-UHFFFAOYSA-M |
| XLogP | -0.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|