C28H55N4+ — CID 159126494
4-tert-butyl-1,1-dimethylpiperidin-1-ium;1-tert-butylpiperazine;4-tert-butylpyridine (PubChem CID 159126494) has the molecular formula C28H55N4+ and a molecular weight of 447.78 g/mol. Its IUPAC name is 4-tert-butyl-1,1-dimethylpiperidin-1-ium;1-tert-butylpiperazine;4-tert-butylpyridine.
| Compound Name | 4-tert-butyl-1,1-dimethylpiperidin-1-ium;1-tert-butylpiperazine;4-tert-butylpyridine |
|---|---|
| PubChem CID | 159126494 |
| Molecular Formula | C28H55N4+ |
| Molecular Weight | 447.78 g/mol |
| Exact Mass | 447.44 |
| IUPAC Name | 4-tert-butyl-1,1-dimethylpiperidin-1-ium;1-tert-butylpiperazine;4-tert-butylpyridine |
| SMILES | CC(C)(C)C1CC[N+](C)(C)CC1.CC(C)(C)N1CCNCC1.CC(C)(C)c1ccncc1 |
| InChI | InChI=1S/C11H24N.C9H13N.C8H18N2/c1-11(2,3)10-6-8-12(4,5)9-7-10;1-9(2,3)8-4-6-10-7-5-8;1-8(2,3)10-6-4-9-5-7-10/h10H,6-9H2,1-5H3;4-7H,1-3H3;9H,4-7H2,1-3H3/q+1;; |
| InChIKey | KGIOQJUNZXTOMQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.78 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|