C8H17INO2+ — CID 175590401
1,1-dimethylpiperidin-1-ium-4-carboxylic acid;hydroiodide (PubChem CID 175590401) has the molecular formula C8H17INO2+ and a molecular weight of 286.13 g/mol. Its IUPAC name is 1,1-dimethylpiperidin-1-ium-4-carboxylic acid;hydroiodide.
| Compound Name | 1,1-dimethylpiperidin-1-ium-4-carboxylic acid;hydroiodide |
|---|---|
| PubChem CID | 175590401 |
| Molecular Formula | C8H17INO2+ |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 1,1-dimethylpiperidin-1-ium-4-carboxylic acid;hydroiodide |
| SMILES | C[N+]1(C)CCC(C(=O)O)CC1.I |
| InChI | InChI=1S/C8H15NO2.HI/c1-9(2)5-3-7(4-6-9)8(10)11;/h7H,3-6H2,1-2H3;1H/p+1 |
| InChIKey | MPWAQDWJTAYJAJ-UHFFFAOYSA-O |
| XLogP | 1.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|