C14H28N3+ — CID 70858397
1-cyclopropyl-4-(1,1-dimethylpiperidin-1-ium-4-yl)piperazine (PubChem CID 70858397) has the molecular formula C14H28N3+ and a molecular weight of 238.40 g/mol. Its IUPAC name is 1-cyclopropyl-4-(1,1-dimethylpiperidin-1-ium-4-yl)piperazine.
| Compound Name | 1-cyclopropyl-4-(1,1-dimethylpiperidin-1-ium-4-yl)piperazine |
|---|---|
| PubChem CID | 70858397 |
| Molecular Formula | C14H28N3+ |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 1-cyclopropyl-4-(1,1-dimethylpiperidin-1-ium-4-yl)piperazine |
| SMILES | C[N+]1(C)CCC(N2CCN(C3CC3)CC2)CC1 |
| InChI | InChI=1S/C14H28N3/c1-17(2)11-5-14(6-12-17)16-9-7-15(8-10-16)13-3-4-13/h13-14H,3-12H2,1-2H3/q+1 |
| InChIKey | GNAPCXBVICREFK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|