C12H26N3O+ — CID 163794406
1,1-dimethyl-4-(1-methyl-1-oxidopiperidin-1-ium-4-yl)piperazin-1-ium (PubChem CID 163794406) has the molecular formula C12H26N3O+ and a molecular weight of 228.36 g/mol. Its IUPAC name is 1,1-dimethyl-4-(1-methyl-1-oxidopiperidin-1-ium-4-yl)piperazin-1-ium.
| Compound Name | 1,1-dimethyl-4-(1-methyl-1-oxidopiperidin-1-ium-4-yl)piperazin-1-ium |
|---|---|
| PubChem CID | 163794406 |
| Molecular Formula | C12H26N3O+ |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 1,1-dimethyl-4-(1-methyl-1-oxidopiperidin-1-ium-4-yl)piperazin-1-ium |
| SMILES | C[N+]1(C)CCN(C2CC[N+](C)([O-])CC2)CC1 |
| InChI | InChI=1S/C12H26N3O/c1-14(2)10-6-13(7-11-14)12-4-8-15(3,16)9-5-12/h12H,4-11H2,1-3H3/q+1 |
| InChIKey | NDXIAZGSNULVST-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|