C19H36N3+ — CID 175622635
2-[1-(1,1-dimethylpiperidin-1-ium-3-yl)piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 175622635) has the molecular formula C19H36N3+ and a molecular weight of 306.52 g/mol. Its IUPAC name is 2-[1-(1,1-dimethylpiperidin-1-ium-3-yl)piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 2-[1-(1,1-dimethylpiperidin-1-ium-3-yl)piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 175622635 |
| Molecular Formula | C19H36N3+ |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | 2-[1-(1,1-dimethylpiperidin-1-ium-3-yl)piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | C[N+]1(C)CCCC(N2CCC(N3CC4CCCC4C3)CC2)C1 |
| InChI | InChI=1S/C19H36N3/c1-22(2)12-4-7-19(15-22)20-10-8-18(9-11-20)21-13-16-5-3-6-17(16)14-21/h16-19H,3-15H2,1-2H3/q+1 |
| InChIKey | ICESVQIEZINWPV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|