C9H19N2O+ — CID 123791277
1,1-dimethyl-4-(oxetan-3-yl)piperazin-1-ium (PubChem CID 123791277) has the molecular formula C9H19N2O+ and a molecular weight of 171.26 g/mol. Its IUPAC name is 1,1-dimethyl-4-(oxetan-3-yl)piperazin-1-ium.
| Compound Name | 1,1-dimethyl-4-(oxetan-3-yl)piperazin-1-ium |
|---|---|
| PubChem CID | 123791277 |
| Molecular Formula | C9H19N2O+ |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | 1,1-dimethyl-4-(oxetan-3-yl)piperazin-1-ium |
| SMILES | C[N+]1(C)CCN(C2COC2)CC1 |
| InChI | InChI=1S/C9H19N2O/c1-11(2)5-3-10(4-6-11)9-7-12-8-9/h9H,3-8H2,1-2H3/q+1 |
| InChIKey | AAWQLCBDMRUQAK-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|