C12H23FN2O — CID 168833186
1-(2,2-dimethylpropyl)-2-fluoro-4-(oxetan-3-yl)piperazine (PubChem CID 168833186) has the molecular formula C12H23FN2O and a molecular weight of 230.33 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-2-fluoro-4-(oxetan-3-yl)piperazine.
| Compound Name | 1-(2,2-dimethylpropyl)-2-fluoro-4-(oxetan-3-yl)piperazine |
|---|---|
| PubChem CID | 168833186 |
| Molecular Formula | C12H23FN2O |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-2-fluoro-4-(oxetan-3-yl)piperazine |
| SMILES | CC(C)(C)CN1CCN(C2COC2)CC1F |
| InChI | InChI=1S/C12H23FN2O/c1-12(2,3)9-15-5-4-14(6-11(15)13)10-7-16-8-10/h10-11H,4-9H2,1-3H3 |
| InChIKey | LJDGTPCZOWBPAJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|