C9H15Br — CID 90900208
5-bromo-1,3-dimethyl-2-methylidenecyclohexane (PubChem CID 90900208) has the molecular formula C9H15Br and a molecular weight of 203.12 g/mol. Its IUPAC name is 5-bromo-1,3-dimethyl-2-methylidenecyclohexane.
| Compound Name | 5-bromo-1,3-dimethyl-2-methylidenecyclohexane |
|---|---|
| PubChem CID | 90900208 |
| Molecular Formula | C9H15Br |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 5-bromo-1,3-dimethyl-2-methylidenecyclohexane |
| SMILES | C=C1C(C)CC(Br)CC1C |
| InChI | InChI=1S/C9H15Br/c1-6-4-9(10)5-7(2)8(6)3/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | ZMRSNVFQZYDPIW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|