C9H12O2 — CID 70519866
4,6-dimethyl-2-methylidenecyclohexane-1,3-dione (PubChem CID 70519866) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 4,6-dimethyl-2-methylidenecyclohexane-1,3-dione.
| Compound Name | 4,6-dimethyl-2-methylidenecyclohexane-1,3-dione |
|---|---|
| PubChem CID | 70519866 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 4,6-dimethyl-2-methylidenecyclohexane-1,3-dione |
| SMILES | C=C1C(=O)C(C)CC(C)C1=O |
| InChI | InChI=1S/C9H12O2/c1-5-4-6(2)9(11)7(3)8(5)10/h5-6H,3-4H2,1-2H3 |
| InChIKey | UQOFCJKNXPGZME-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|