C20H44N2+2 — CID 159989593
3,4-diethyl-1,1-dimethylpyrrolidin-1-ium;3-ethyl-1,1,5-trimethylpiperidin-1-ium (PubChem CID 159989593) has the molecular formula C20H44N2+2 and a molecular weight of 312.59 g/mol. Its IUPAC name is 3,4-diethyl-1,1-dimethylpyrrolidin-1-ium;3-ethyl-1,1,5-trimethylpiperidin-1-ium.
| Compound Name | 3,4-diethyl-1,1-dimethylpyrrolidin-1-ium;3-ethyl-1,1,5-trimethylpiperidin-1-ium |
|---|---|
| PubChem CID | 159989593 |
| Molecular Formula | C20H44N2+2 |
| Molecular Weight | 312.59 g/mol |
| Exact Mass | 312.35 |
| IUPAC Name | 3,4-diethyl-1,1-dimethylpyrrolidin-1-ium;3-ethyl-1,1,5-trimethylpiperidin-1-ium |
| SMILES | CCC1CC(C)C[N+](C)(C)C1.CCC1C[N+](C)(C)CC1CC |
| InChI | InChI=1S/2C10H22N/c1-5-10-6-9(2)7-11(3,4)8-10;1-5-9-7-11(3,4)8-10(9)6-2/h2*9-10H,5-8H2,1-4H3/q2*+1 |
| InChIKey | OGTXUEHCTHWRMV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|