C11H32Cl2O5Si6 — CID 15466488
2,8-dichloro-2,4,4,6,6,8,10,10,12,12-decamethyl-1,3,5,7,9-pentaoxa-2,4,6,8,10,12-hexasilacyclododecane (PubChem CID 15466488) has the molecular formula C11H32Cl2O5Si6 and a molecular weight of 483.79 g/mol. Its IUPAC name is 2,8-dichloro-2,4,4,6,6,8,10,10,12,12-decamethyl-1,3,5,7,9-pentaoxa-2,4,6,8,10,12-hexasilacyclododecane.
| Compound Name | 2,8-dichloro-2,4,4,6,6,8,10,10,12,12-decamethyl-1,3,5,7,9-pentaoxa-2,4,6,8,10,12-hexasilacyclododecane |
|---|---|
| PubChem CID | 15466488 |
| Molecular Formula | C11H32Cl2O5Si6 |
| Molecular Weight | 483.79 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | 2,8-dichloro-2,4,4,6,6,8,10,10,12,12-decamethyl-1,3,5,7,9-pentaoxa-2,4,6,8,10,12-hexasilacyclododecane |
| SMILES | C[Si]1(C)C[Si](C)(C)O[Si](C)(Cl)O[Si](C)(C)O[Si](C)(C)O[Si](C)(Cl)O1 |
| InChI | InChI=1S/C11H32Cl2O5Si6/c1-19(2)11-20(3,4)15-24(10,13)18-22(7,8)16-21(5,6)17-23(9,12)14-19/h11H2,1-10H3 |
| InChIKey | OAESBBZIFZTMMM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.79 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|