C11H30OSi4 — CID 623763
2,2,4,4,6,6,8,8-octamethyl-1,2,4,6,8-oxatetrasilocane (PubChem CID 623763) has the molecular formula C11H30OSi4 and a molecular weight of 290.70 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8-octamethyl-1,2,4,6,8-oxatetrasilocane.
| Compound Name | 2,2,4,4,6,6,8,8-octamethyl-1,2,4,6,8-oxatetrasilocane |
|---|---|
| PubChem CID | 623763 |
| Molecular Formula | C11H30OSi4 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2,2,4,4,6,6,8,8-octamethyl-1,2,4,6,8-oxatetrasilocane |
| SMILES | C[Si]1(C)C[Si](C)(C)C[Si](C)(C)O[Si](C)(C)C1 |
| InChI | InChI=1S/C11H30OSi4/c1-13(2)9-14(3,4)11-16(7,8)12-15(5,6)10-13/h9-11H2,1-8H3 |
| InChIKey | YSAHUKHCGNRDQI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|