C11H29NOSi3 — CID 164522227
2,2,5,7,7,9,9-heptamethyl-1,3,2,7,9-oxazatrisilonane (PubChem CID 164522227) has the molecular formula C11H29NOSi3 and a molecular weight of 275.62 g/mol. Its IUPAC name is 2,2,5,7,7,9,9-heptamethyl-1,3,2,7,9-oxazatrisilonane.
| Compound Name | 2,2,5,7,7,9,9-heptamethyl-1,3,2,7,9-oxazatrisilonane |
|---|---|
| PubChem CID | 164522227 |
| Molecular Formula | C11H29NOSi3 |
| Molecular Weight | 275.62 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2,2,5,7,7,9,9-heptamethyl-1,3,2,7,9-oxazatrisilonane |
| SMILES | CC1CN[Si](C)(C)O[Si](C)(C)C[Si](C)(C)C1 |
| InChI | InChI=1S/C11H29NOSi3/c1-11-8-12-16(6,7)13-15(4,5)10-14(2,3)9-11/h11-12H,8-10H2,1-7H3 |
| InChIKey | BOJBGSLUJACKGE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|