C10H22OSi2 — CID 71387894
1-(1,3-dimethylsiletan-1-yl)oxy-1,3-dimethylsiletane (PubChem CID 71387894) has the molecular formula C10H22OSi2 and a molecular weight of 214.46 g/mol. Its IUPAC name is 1-(1,3-dimethylsiletan-1-yl)oxy-1,3-dimethylsiletane.
| Compound Name | 1-(1,3-dimethylsiletan-1-yl)oxy-1,3-dimethylsiletane |
|---|---|
| PubChem CID | 71387894 |
| Molecular Formula | C10H22OSi2 |
| Molecular Weight | 214.46 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-(1,3-dimethylsiletan-1-yl)oxy-1,3-dimethylsiletane |
| SMILES | CC1C[Si](C)(O[Si]2(C)CC(C)C2)C1 |
| InChI | InChI=1S/C10H22OSi2/c1-9-5-12(3,6-9)11-13(4)7-10(2)8-13/h9-10H,5-8H2,1-4H3 |
| InChIKey | AJWOJDUMYBWLLO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|