C9H22Si2 — CID 91481899
(4R,5S)-1,1,3,3,4,5-hexamethyl-1,3-disilolane (PubChem CID 91481899) has the molecular formula C9H22Si2 and a molecular weight of 186.45 g/mol. Its IUPAC name is (4R,5S)-1,1,3,3,4,5-hexamethyl-1,3-disilolane.
| Compound Name | (4R,5S)-1,1,3,3,4,5-hexamethyl-1,3-disilolane |
|---|---|
| PubChem CID | 91481899 |
| Molecular Formula | C9H22Si2 |
| Molecular Weight | 186.45 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (4R,5S)-1,1,3,3,4,5-hexamethyl-1,3-disilolane |
| SMILES | C[C@@H]1[C@H](C)[Si](C)(C)C[Si]1(C)C |
| InChI | InChI=1S/C9H22Si2/c1-8-9(2)11(5,6)7-10(8,3)4/h8-9H,7H2,1-6H3/t8-,9+ |
| InChIKey | ZXCJFCSJDZJPPD-DTORHVGOSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|