C9H25NO2Si3 — CID 156746732
2,2,4,4,9,9-hexamethyl-1,3,5,2,4,9-dioxazatrisilonane (PubChem CID 156746732) has the molecular formula C9H25NO2Si3 and a molecular weight of 263.56 g/mol. Its IUPAC name is 2,2,4,4,9,9-hexamethyl-1,3,5,2,4,9-dioxazatrisilonane.
| Compound Name | 2,2,4,4,9,9-hexamethyl-1,3,5,2,4,9-dioxazatrisilonane |
|---|---|
| PubChem CID | 156746732 |
| Molecular Formula | C9H25NO2Si3 |
| Molecular Weight | 263.56 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2,2,4,4,9,9-hexamethyl-1,3,5,2,4,9-dioxazatrisilonane |
| SMILES | C[Si]1(C)CCCN[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C9H25NO2Si3/c1-13(2)9-7-8-10-14(3,4)12-15(5,6)11-13/h10H,7-9H2,1-6H3 |
| InChIKey | MFGZWHGZUTZADO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|