C8H20N2OSi — CID 164778564
2-ethoxy-2-methyl-1,6,2-diazasilocane (PubChem CID 164778564) has the molecular formula C8H20N2OSi and a molecular weight of 188.35 g/mol. Its IUPAC name is 2-ethoxy-2-methyl-1,6,2-diazasilocane.
| Compound Name | 2-ethoxy-2-methyl-1,6,2-diazasilocane |
|---|---|
| PubChem CID | 164778564 |
| Molecular Formula | C8H20N2OSi |
| Molecular Weight | 188.35 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-ethoxy-2-methyl-1,6,2-diazasilocane |
| SMILES | CCO[Si]1(C)CCCNCCN1 |
| InChI | InChI=1S/C8H20N2OSi/c1-3-11-12(2)8-4-5-9-6-7-10-12/h9-10H,3-8H2,1-2H3 |
| InChIKey | ADUSQOVRHPGNTF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|