C10H24O2Si2 — CID 140867723
1,4-diethoxy-1,4-dimethyl-1,4-disilinane (PubChem CID 140867723) has the molecular formula C10H24O2Si2 and a molecular weight of 232.47 g/mol. Its IUPAC name is 1,4-diethoxy-1,4-dimethyl-1,4-disilinane.
| Compound Name | 1,4-diethoxy-1,4-dimethyl-1,4-disilinane |
|---|---|
| PubChem CID | 140867723 |
| Molecular Formula | C10H24O2Si2 |
| Molecular Weight | 232.47 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1,4-diethoxy-1,4-dimethyl-1,4-disilinane |
| SMILES | CCO[Si]1(C)CC[Si](C)(OCC)CC1 |
| InChI | InChI=1S/C10H24O2Si2/c1-5-11-13(3)7-9-14(4,10-8-13)12-6-2/h5-10H2,1-4H3 |
| InChIKey | SFESTSCPFLVMSE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|