About CID 59245328
CID 59245328 (PubChem CID 59245328) has the molecular formula C6H16O2Si2
and a molecular weight of 176.36 g/mol.
Molecular Properties
| Compound Name | CID 59245328 |
| PubChem CID | 59245328 |
| Molecular Formula | C6H16O2Si2 |
| Molecular Weight | 176.36 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | — |
| SMILES | CCO[Si](C)[Si](C)OCC |
| InChI | InChI=1S/C6H16O2Si2/c1-5-7-9(3)10(4)8-6-2/h5-6H2,1-4H3 |
| InChIKey | CVNQCNVPKSMGIJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59245328 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59245328?
The IUPAC name of CID 59245328 (CID 59245328) is not available.
What is the SMILES notation for CID 59245328?
The canonical SMILES for CID 59245328 is CCO[Si](C)[Si](C)OCC.
What is the InChIKey of CID 59245328?
The InChIKey is CVNQCNVPKSMGIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O2Si2/c1-5-7-9(3)10(4)8-6-2/h5-6H2,1-4H3.
What are the key properties of CID 59245328?
CID 59245328 has a molecular weight of 176.36 g/mol, XLogP of 1.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59245328 is sourced from PubChem (CID 59245328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).