About lithium ethoxy-oxido-oxosilane
lithium ethoxy-oxido-oxosilane (PubChem CID 23678558) has the molecular formula C2H5LiO3Si
and a molecular weight of 112.09 g/mol. Its IUPAC name is lithium ethoxy-oxido-oxosilane.
Molecular Properties
| Compound Name | lithium ethoxy-oxido-oxosilane |
| PubChem CID | 23678558 |
| Molecular Formula | C2H5LiO3Si |
| Molecular Weight | 112.09 g/mol |
| Exact Mass | 112.02 |
| IUPAC Name | lithium ethoxy-oxido-oxosilane |
| SMILES | CCO[Si](=O)[O-].[Li+] |
| InChI | InChI=1S/C2H5O3Si.Li/c1-2-5-6(3)4;/h2H2,1H3;/q-1;+1 |
| InChIKey | JQVIGHYXRTWXOS-UHFFFAOYSA-N |
| XLogP | -4.20 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.09 |
| LogP ≤ 5 | -4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium ethoxy-oxido-oxosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium ethoxy-oxido-oxosilane?
The IUPAC name of lithium ethoxy-oxido-oxosilane (CID 23678558) is lithium ethoxy-oxido-oxosilane.
What is the SMILES notation for lithium ethoxy-oxido-oxosilane?
The canonical SMILES for lithium ethoxy-oxido-oxosilane is CCO[Si](=O)[O-].[Li+].
What is the InChIKey of lithium ethoxy-oxido-oxosilane?
The InChIKey is JQVIGHYXRTWXOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5O3Si.Li/c1-2-5-6(3)4;/h2H2,1H3;/q-1;+1.
What are the key properties of lithium ethoxy-oxido-oxosilane?
lithium ethoxy-oxido-oxosilane has a molecular weight of 112.09 g/mol, XLogP of -4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium ethoxy-oxido-oxosilane is sourced from PubChem (CID 23678558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).