About ethanol;ethoxy-hydroxy-oxosilane
ethanol;ethoxy-hydroxy-oxosilane (PubChem CID 87450344) has the molecular formula C4H12O4Si
and a molecular weight of 152.22 g/mol. Its IUPAC name is ethanol;ethoxy-hydroxy-oxosilane.
Molecular Properties
| Compound Name | ethanol;ethoxy-hydroxy-oxosilane |
| PubChem CID | 87450344 |
| Molecular Formula | C4H12O4Si |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | ethanol;ethoxy-hydroxy-oxosilane |
| SMILES | CCO.CCO[Si](=O)O |
| InChI | InChI=1S/C2H6O3Si.C2H6O/c1-2-5-6(3)4;1-2-3/h3H,2H2,1H3;3H,2H2,1H3 |
| InChIKey | RWAPGOSJOZJQPJ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethanol;ethoxy-hydroxy-oxosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;ethoxy-hydroxy-oxosilane?
The IUPAC name of ethanol;ethoxy-hydroxy-oxosilane (CID 87450344) is ethanol;ethoxy-hydroxy-oxosilane.
What is the SMILES notation for ethanol;ethoxy-hydroxy-oxosilane?
The canonical SMILES for ethanol;ethoxy-hydroxy-oxosilane is CCO.CCO[Si](=O)O.
What is the InChIKey of ethanol;ethoxy-hydroxy-oxosilane?
The InChIKey is RWAPGOSJOZJQPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6O3Si.C2H6O/c1-2-5-6(3)4;1-2-3/h3H,2H2,1H3;3H,2H2,1H3.
What are the key properties of ethanol;ethoxy-hydroxy-oxosilane?
ethanol;ethoxy-hydroxy-oxosilane has a molecular weight of 152.22 g/mol, XLogP of -0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;ethoxy-hydroxy-oxosilane is sourced from PubChem (CID 87450344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).