About butoxy-hydroxy-oxosilane;urea
butoxy-hydroxy-oxosilane;urea (PubChem CID 88805411) has the molecular formula C5H14N2O4Si
and a molecular weight of 194.26 g/mol. Its IUPAC name is butoxy-hydroxy-oxosilane;urea.
Molecular Properties
| Compound Name | butoxy-hydroxy-oxosilane;urea |
| PubChem CID | 88805411 |
| Molecular Formula | C5H14N2O4Si |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | butoxy-hydroxy-oxosilane;urea |
| SMILES | CCCCO[Si](=O)O.NC(N)=O |
| InChI | InChI=1S/C4H10O3Si.CH4N2O/c1-2-3-4-7-8(5)6;2-1(3)4/h5H,2-4H2,1H3;(H4,2,3,4) |
| InChIKey | IVWUGZYGEOMMKU-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butoxy-hydroxy-oxosilane;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxy-hydroxy-oxosilane;urea?
The IUPAC name of butoxy-hydroxy-oxosilane;urea (CID 88805411) is butoxy-hydroxy-oxosilane;urea.
What is the SMILES notation for butoxy-hydroxy-oxosilane;urea?
The canonical SMILES for butoxy-hydroxy-oxosilane;urea is CCCCO[Si](=O)O.NC(N)=O.
What is the InChIKey of butoxy-hydroxy-oxosilane;urea?
The InChIKey is IVWUGZYGEOMMKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3Si.CH4N2O/c1-2-3-4-7-8(5)6;2-1(3)4/h5H,2-4H2,1H3;(H4,2,3,4).
What are the key properties of butoxy-hydroxy-oxosilane;urea?
butoxy-hydroxy-oxosilane;urea has a molecular weight of 194.26 g/mol, XLogP of -0.77, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butoxy-hydroxy-oxosilane;urea is sourced from PubChem (CID 88805411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).