About dioxido(oxo)silane;lead(2+);phosphane
dioxido(oxo)silane;lead(2+);phosphane (PubChem CID 173423825) has the molecular formula H3O3PPbSi
and a molecular weight of 317.28 g/mol. Its IUPAC name is dioxido(oxo)silane;lead(2+);phosphane.
Molecular Properties
| Compound Name | dioxido(oxo)silane;lead(2+);phosphane |
| PubChem CID | 173423825 |
| Molecular Formula | H3O3PPbSi |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.94 |
| IUPAC Name | dioxido(oxo)silane;lead(2+);phosphane |
| SMILES | O=[Si]([O-])[O-].P.[Pb+2] |
| InChI | InChI=1S/O3Si.H3P.Pb/c1-4(2)3;;/h;1H3;/q-2;;+2 |
| InChIKey | PYFVNSZFYMBEBY-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxo)silane;lead(2+);phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)silane;lead(2+);phosphane?
The IUPAC name of dioxido(oxo)silane;lead(2+);phosphane (CID 173423825) is dioxido(oxo)silane;lead(2+);phosphane.
What is the SMILES notation for dioxido(oxo)silane;lead(2+);phosphane?
The canonical SMILES for dioxido(oxo)silane;lead(2+);phosphane is O=[Si]([O-])[O-].P.[Pb+2].
What is the InChIKey of dioxido(oxo)silane;lead(2+);phosphane?
The InChIKey is PYFVNSZFYMBEBY-UHFFFAOYSA-N. The full InChI is InChI=1S/O3Si.H3P.Pb/c1-4(2)3;;/h;1H3;/q-2;;+2.
What are the key properties of dioxido(oxo)silane;lead(2+);phosphane?
dioxido(oxo)silane;lead(2+);phosphane has a molecular weight of 317.28 g/mol, XLogP of -3.20, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)silane;lead(2+);phosphane is sourced from PubChem (CID 173423825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).