About dioxido(oxo)silane;rhodium(2+)
dioxido(oxo)silane;rhodium(2+) (PubChem CID 19598913) has the molecular formula O3RhSi
and a molecular weight of 178.99 g/mol. Its IUPAC name is dioxido(oxo)silane;rhodium(2+).
Molecular Properties
| Compound Name | dioxido(oxo)silane;rhodium(2+) |
| PubChem CID | 19598913 |
| Molecular Formula | O3RhSi |
| Molecular Weight | 178.99 g/mol |
| Exact Mass | 178.87 |
| IUPAC Name | dioxido(oxo)silane;rhodium(2+) |
| SMILES | O=[Si]([O-])[O-].[Rh+2] |
| InChI | InChI=1S/O3Si.Rh/c1-4(2)3;/q-2;+2 |
| InChIKey | KKNILDPNHMQMAS-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.99 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxo)silane;rhodium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)silane;rhodium(2+)?
The IUPAC name of dioxido(oxo)silane;rhodium(2+) (CID 19598913) is dioxido(oxo)silane;rhodium(2+).
What is the SMILES notation for dioxido(oxo)silane;rhodium(2+)?
The canonical SMILES for dioxido(oxo)silane;rhodium(2+) is O=[Si]([O-])[O-].[Rh+2].
What is the InChIKey of dioxido(oxo)silane;rhodium(2+)?
The InChIKey is KKNILDPNHMQMAS-UHFFFAOYSA-N. The full InChI is InChI=1S/O3Si.Rh/c1-4(2)3;/q-2;+2.
What are the key properties of dioxido(oxo)silane;rhodium(2+)?
dioxido(oxo)silane;rhodium(2+) has a molecular weight of 178.99 g/mol, XLogP of -2.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)silane;rhodium(2+) is sourced from PubChem (CID 19598913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).