About dioxido(oxo)silane;oxygen(2-);titanium(4+)
dioxido(oxo)silane;oxygen(2-);titanium(4+) (PubChem CID 22325882) has the molecular formula O4SiTi
and a molecular weight of 139.95 g/mol. Its IUPAC name is dioxido(oxo)silane;oxygen(2-);titanium(4+).
Molecular Properties
| Compound Name | dioxido(oxo)silane;oxygen(2-);titanium(4+) |
| PubChem CID | 22325882 |
| Molecular Formula | O4SiTi |
| Molecular Weight | 139.95 g/mol |
| Exact Mass | 139.90 |
| IUPAC Name | dioxido(oxo)silane;oxygen(2-);titanium(4+) |
| SMILES | O=[Si]([O-])[O-].[O-2].[Ti+4] |
| InChI | InChI=1S/O3Si.O.Ti/c1-4(2)3;;/q2*-2;+4 |
| InChIKey | CCKZAYMYINCDKT-UHFFFAOYSA-N |
| XLogP | -3.00 |
| TPSA | 91.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.95 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxo)silane;oxygen(2-);titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)silane;oxygen(2-);titanium(4+)?
The IUPAC name of dioxido(oxo)silane;oxygen(2-);titanium(4+) (CID 22325882) is dioxido(oxo)silane;oxygen(2-);titanium(4+).
What is the SMILES notation for dioxido(oxo)silane;oxygen(2-);titanium(4+)?
The canonical SMILES for dioxido(oxo)silane;oxygen(2-);titanium(4+) is O=[Si]([O-])[O-].[O-2].[Ti+4].
What is the InChIKey of dioxido(oxo)silane;oxygen(2-);titanium(4+)?
The InChIKey is CCKZAYMYINCDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/O3Si.O.Ti/c1-4(2)3;;/q2*-2;+4.
What are the key properties of dioxido(oxo)silane;oxygen(2-);titanium(4+)?
dioxido(oxo)silane;oxygen(2-);titanium(4+) has a molecular weight of 139.95 g/mol, XLogP of -3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)silane;oxygen(2-);titanium(4+) is sourced from PubChem (CID 22325882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).