About cesium hexoxy-oxido-oxosilane
cesium hexoxy-oxido-oxosilane (PubChem CID 87731431) has the molecular formula C6H13CsO3Si
and a molecular weight of 294.16 g/mol. Its IUPAC name is cesium hexoxy-oxido-oxosilane.
Molecular Properties
| Compound Name | cesium hexoxy-oxido-oxosilane |
| PubChem CID | 87731431 |
| Molecular Formula | C6H13CsO3Si |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | cesium hexoxy-oxido-oxosilane |
| SMILES | CCCCCCO[Si](=O)[O-].[Cs+] |
| InChI | InChI=1S/C6H13O3Si.Cs/c1-2-3-4-5-6-9-10(7)8;/h2-6H2,1H3;/q-1;+1 |
| InChIKey | YHSASIIEHTZXCY-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cesium hexoxy-oxido-oxosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium hexoxy-oxido-oxosilane?
The IUPAC name of cesium hexoxy-oxido-oxosilane (CID 87731431) is cesium hexoxy-oxido-oxosilane.
What is the SMILES notation for cesium hexoxy-oxido-oxosilane?
The canonical SMILES for cesium hexoxy-oxido-oxosilane is CCCCCCO[Si](=O)[O-].[Cs+].
What is the InChIKey of cesium hexoxy-oxido-oxosilane?
The InChIKey is YHSASIIEHTZXCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O3Si.Cs/c1-2-3-4-5-6-9-10(7)8;/h2-6H2,1H3;/q-1;+1.
What are the key properties of cesium hexoxy-oxido-oxosilane?
cesium hexoxy-oxido-oxosilane has a molecular weight of 294.16 g/mol, XLogP of -2.64, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cesium hexoxy-oxido-oxosilane is sourced from PubChem (CID 87731431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).