About hexoxy-oxido-oxosilane;tetramethylazanium
hexoxy-oxido-oxosilane;tetramethylazanium (PubChem CID 87730369) has the molecular formula C10H25NO3Si
and a molecular weight of 235.40 g/mol. Its IUPAC name is hexoxy-oxido-oxosilane;tetramethylazanium.
Molecular Properties
| Compound Name | hexoxy-oxido-oxosilane;tetramethylazanium |
| PubChem CID | 87730369 |
| Molecular Formula | C10H25NO3Si |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | hexoxy-oxido-oxosilane;tetramethylazanium |
| SMILES | CCCCCCO[Si](=O)[O-].C[N+](C)(C)C |
| InChI | InChI=1S/C6H13O3Si.C4H12N/c1-2-3-4-5-6-9-10(7)8;1-5(2,3)4/h2-6H2,1H3;1-4H3/q-1;+1 |
| InChIKey | OTKVGRRZNPITAS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hexoxy-oxido-oxosilane;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexoxy-oxido-oxosilane;tetramethylazanium?
The IUPAC name of hexoxy-oxido-oxosilane;tetramethylazanium (CID 87730369) is hexoxy-oxido-oxosilane;tetramethylazanium.
What is the SMILES notation for hexoxy-oxido-oxosilane;tetramethylazanium?
The canonical SMILES for hexoxy-oxido-oxosilane;tetramethylazanium is CCCCCCO[Si](=O)[O-].C[N+](C)(C)C.
What is the InChIKey of hexoxy-oxido-oxosilane;tetramethylazanium?
The InChIKey is OTKVGRRZNPITAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O3Si.C4H12N/c1-2-3-4-5-6-9-10(7)8;1-5(2,3)4/h2-6H2,1H3;1-4H3/q-1;+1.
What are the key properties of hexoxy-oxido-oxosilane;tetramethylazanium?
hexoxy-oxido-oxosilane;tetramethylazanium has a molecular weight of 235.40 g/mol, XLogP of 0.68, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexoxy-oxido-oxosilane;tetramethylazanium is sourced from PubChem (CID 87730369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).