About CID 18625205
CID 18625205 (PubChem CID 18625205) has the molecular formula C3H8O2Si2
and a molecular weight of 132.27 g/mol.
Molecular Properties
| Compound Name | CID 18625205 |
| PubChem CID | 18625205 |
| Molecular Formula | C3H8O2Si2 |
| Molecular Weight | 132.27 g/mol |
| Exact Mass | 132.01 |
| IUPAC Name | — |
| SMILES | CCO[Si](C)O[Si] |
| InChI | InChI=1S/C3H8O2Si2/c1-3-4-7(2)5-6/h3H2,1-2H3 |
| InChIKey | WEODLURFSUQSPZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18625205 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18625205?
The IUPAC name of CID 18625205 (CID 18625205) is not available.
What is the SMILES notation for CID 18625205?
The canonical SMILES for CID 18625205 is CCO[Si](C)O[Si].
What is the InChIKey of CID 18625205?
The InChIKey is WEODLURFSUQSPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2Si2/c1-3-4-7(2)5-6/h3H2,1-2H3.
What are the key properties of CID 18625205?
CID 18625205 has a molecular weight of 132.27 g/mol, XLogP of 0.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18625205 is sourced from PubChem (CID 18625205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).